C24H29N7O2 — CID 144832071
N-[2-(4-cyclopropyloxy-3-pyridinyl)propyl]-6-[5-methanimidoyl-6-(2-methoxyethylamino)-3-pyridinyl]pyrimidin-4-amine (PubChem CID 144832071) has the molecular formula C24H29N7O2 and a molecular weight of 447.54 g/mol. Its IUPAC name is N-[2-(4-cyclopropyloxy-3-pyridinyl)propyl]-6-[5-methanimidoyl-6-(2-methoxyethylamino)-3-pyridinyl]pyrimidin-4-amine.
| Compound Name | N-[2-(4-cyclopropyloxy-3-pyridinyl)propyl]-6-[5-methanimidoyl-6-(2-methoxyethylamino)-3-pyridinyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 144832071 |
| Molecular Formula | C24H29N7O2 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | N-[2-(4-cyclopropyloxy-3-pyridinyl)propyl]-6-[5-methanimidoyl-6-(2-methoxyethylamino)-3-pyridinyl]pyrimidin-4-amine |
| SMILES | [H]/N=C/c1cc(-c2cc(NCC(C)c3cnccc3OC3CC3)ncn2)cnc1NCCOC |
| InChI | InChI=1S/C24H29N7O2/c1-16(20-14-26-6-5-22(20)33-19-3-4-19)12-28-23-10-21(30-15-31-23)18-9-17(11-25)24(29-13-18)27-7-8-32-2/h5-6,9-11,13-16,19,25H,3-4,7-8,12H2,1-2H3,(H,27,29)(H,28,30,31)/b25-11+ |
| InChIKey | MWHFLVRIFUWKBR-OPEKNORGSA-N |
| XLogP | 3.75 |
| TPSA | 117.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|