About (E)-4-imidazol-1-yl-N-propan-2-ylbut-2-enamide;molecular hydrogen
(E)-4-imidazol-1-yl-N-propan-2-ylbut-2-enamide;molecular hydrogen (PubChem CID 144833032) has the molecular formula C10H17N3O
and a molecular weight of 195.27 g/mol. Its IUPAC name is (E)-4-imidazol-1-yl-N-propan-2-ylbut-2-enamide;molecular hydrogen.
Molecular Properties
| Compound Name | (E)-4-imidazol-1-yl-N-propan-2-ylbut-2-enamide;molecular hydrogen |
| PubChem CID | 144833032 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | (E)-4-imidazol-1-yl-N-propan-2-ylbut-2-enamide;molecular hydrogen |
| SMILES | CC(C)NC(=O)/C=C/Cn1ccnc1.[H][H] |
| InChI | InChI=1S/C10H15N3O.H2/c1-9(2)12-10(14)4-3-6-13-7-5-11-8-13;/h3-5,7-9H,6H2,1-2H3,(H,12,14);1H/b4-3+; |
| InChIKey | LVXYKDGMEMLXQE-BJILWQEISA-N |
| XLogP | 1.21 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-imidazol-1-yl-N-propan-2-ylbut-2-enamide;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-imidazol-1-yl-N-propan-2-ylbut-2-enamide;molecular hydrogen?
The IUPAC name of (E)-4-imidazol-1-yl-N-propan-2-ylbut-2-enamide;molecular hydrogen (CID 144833032) is (E)-4-imidazol-1-yl-N-propan-2-ylbut-2-enamide;molecular hydrogen.
What is the SMILES notation for (E)-4-imidazol-1-yl-N-propan-2-ylbut-2-enamide;molecular hydrogen?
The canonical SMILES for (E)-4-imidazol-1-yl-N-propan-2-ylbut-2-enamide;molecular hydrogen is CC(C)NC(=O)/C=C/Cn1ccnc1.[H][H].
What is the InChIKey of (E)-4-imidazol-1-yl-N-propan-2-ylbut-2-enamide;molecular hydrogen?
The InChIKey is LVXYKDGMEMLXQE-BJILWQEISA-N. The full InChI is InChI=1S/C10H15N3O.H2/c1-9(2)12-10(14)4-3-6-13-7-5-11-8-13;/h3-5,7-9H,6H2,1-2H3,(H,12,14);1H/b4-3+;.
What are the key properties of (E)-4-imidazol-1-yl-N-propan-2-ylbut-2-enamide;molecular hydrogen?
(E)-4-imidazol-1-yl-N-propan-2-ylbut-2-enamide;molecular hydrogen has a molecular weight of 195.27 g/mol, XLogP of 1.21, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-imidazol-1-yl-N-propan-2-ylbut-2-enamide;molecular hydrogen is sourced from PubChem (CID 144833032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).