About 2-(hydroxymethyl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide
2-(hydroxymethyl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide (PubChem CID 144833580) has the molecular formula C10H13N3O2
and a molecular weight of 207.23 g/mol. Its IUPAC name is 2-(hydroxymethyl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide.
Molecular Properties
| Compound Name | 2-(hydroxymethyl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide |
| PubChem CID | 144833580 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 2-(hydroxymethyl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide |
| SMILES | NC(=O)N1c2ncccc2CCC1CO |
| InChI | InChI=1S/C10H13N3O2/c11-10(15)13-8(6-14)4-3-7-2-1-5-12-9(7)13/h1-2,5,8,14H,3-4,6H2,(H2,11,15) |
| InChIKey | RXTNRMMDCARKNS-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 79.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(hydroxymethyl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hydroxymethyl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide?
The IUPAC name of 2-(hydroxymethyl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide (CID 144833580) is 2-(hydroxymethyl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide.
What is the SMILES notation for 2-(hydroxymethyl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide?
The canonical SMILES for 2-(hydroxymethyl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide is NC(=O)N1c2ncccc2CCC1CO.
What is the InChIKey of 2-(hydroxymethyl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide?
The InChIKey is RXTNRMMDCARKNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O2/c11-10(15)13-8(6-14)4-3-7-2-1-5-12-9(7)13/h1-2,5,8,14H,3-4,6H2,(H2,11,15).
What are the key properties of 2-(hydroxymethyl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide?
2-(hydroxymethyl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide has a molecular weight of 207.23 g/mol, XLogP of 0.27, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hydroxymethyl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide is sourced from PubChem (CID 144833580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).