C22H20FN7O — CID 144835162
2-[1-(8,9-dihydro-7H-purin-6-ylamino)propyl]-6-fluoro-3-phenylquinazolin-4-one (PubChem CID 144835162) has the molecular formula C22H20FN7O and a molecular weight of 417.45 g/mol. Its IUPAC name is 2-[1-(8,9-dihydro-7H-purin-6-ylamino)propyl]-6-fluoro-3-phenylquinazolin-4-one.
| Compound Name | 2-[1-(8,9-dihydro-7H-purin-6-ylamino)propyl]-6-fluoro-3-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 144835162 |
| Molecular Formula | C22H20FN7O |
| Molecular Weight | 417.45 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 2-[1-(8,9-dihydro-7H-purin-6-ylamino)propyl]-6-fluoro-3-phenylquinazolin-4-one |
| SMILES | CCC(Nc1ncnc2c1NCN2)c1nc2ccc(F)cc2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C22H20FN7O/c1-2-16(28-20-18-19(25-11-24-18)26-12-27-20)21-29-17-9-8-13(23)10-15(17)22(31)30(21)14-6-4-3-5-7-14/h3-10,12,16,24H,2,11H2,1H3,(H2,25,26,27,28) |
| InChIKey | LFYLQDJTPWRKOQ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.45 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |