C26H35N6O8PS — CID 144836307
propan-2-yl (2R)-2-[[[(1R,3S,4R,7S)-3-[(2-amino-6-ethoxypurin-9-yl)methyl]-7-hydroxy-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate (PubChem CID 144836307) has the molecular formula C26H35N6O8PS and a molecular weight of 622.64 g/mol. Its IUPAC name is propan-2-yl (2R)-2-[[[(1R,3S,4R,7S)-3-[(2-amino-6-ethoxypurin-9-yl)methyl]-7-hydroxy-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate.
| Compound Name | propan-2-yl (2R)-2-[[[(1R,3S,4R,7S)-3-[(2-amino-6-ethoxypurin-9-yl)methyl]-7-hydroxy-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate |
|---|---|
| PubChem CID | 144836307 |
| Molecular Formula | C26H35N6O8PS |
| Molecular Weight | 622.64 g/mol |
| Exact Mass | 622.20 |
| IUPAC Name | propan-2-yl (2R)-2-[[[(1R,3S,4R,7S)-3-[(2-amino-6-ethoxypurin-9-yl)methyl]-7-hydroxy-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate |
| SMILES | CCOc1nc(N)nc2c1ncn2C[C@@H]1O[C@@]2(CO[P@](=S)(N[C@H](C)C(=O)OC(C)C)Oc3ccccc3)CO[C@@H]1[C@@H]2O |
| InChI | InChI=1S/C26H35N6O8PS/c1-5-35-23-19-22(29-25(27)30-23)32(14-28-19)11-18-20-21(33)26(39-18,12-36-20)13-37-41(42,40-17-9-7-6-8-10-17)31-16(4)24(34)38-15(2)3/h6-10,14-16,18,20-21,33H,5,11-13H2,1-4H3,(H,31,42)(H2,27,29,30)/t16-,18+,20+,21+,26-,41-/m1/s1 |
| InChIKey | SZMPQWVRFDCXMG-GLHVXMRBSA-N |
| XLogP | 1.95 |
| TPSA | 174.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.64 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|