C16H20ClN5O2 — CID 144838717
1,3-diamino-1-[2-[(5-chlorofuran-2-yl)methyl-methylamino]-3-cyclopropylphenyl]urea (PubChem CID 144838717) has the molecular formula C16H20ClN5O2 and a molecular weight of 349.82 g/mol. Its IUPAC name is 1,3-diamino-1-[2-[(5-chlorofuran-2-yl)methyl-methylamino]-3-cyclopropylphenyl]urea.
| Compound Name | 1,3-diamino-1-[2-[(5-chlorofuran-2-yl)methyl-methylamino]-3-cyclopropylphenyl]urea |
|---|---|
| PubChem CID | 144838717 |
| Molecular Formula | C16H20ClN5O2 |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 1,3-diamino-1-[2-[(5-chlorofuran-2-yl)methyl-methylamino]-3-cyclopropylphenyl]urea |
| SMILES | CN(Cc1ccc(Cl)o1)c1c(C2CC2)cccc1N(N)C(=O)NN |
| InChI | InChI=1S/C16H20ClN5O2/c1-21(9-11-7-8-14(17)24-11)15-12(10-5-6-10)3-2-4-13(15)22(19)16(23)20-18/h2-4,7-8,10H,5-6,9,18-19H2,1H3,(H,20,23) |
| InChIKey | CEESJDXOZZIKOB-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 100.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|