C17H24N4OS2 — CID 144838377
1,3-diamino-1-[3-cyclobutyl-2-(thiophen-2-ylmethylsulfanyl)phenyl]urea;methane (PubChem CID 144838377) has the molecular formula C17H24N4OS2 and a molecular weight of 364.54 g/mol. Its IUPAC name is 1,3-diamino-1-[3-cyclobutyl-2-(thiophen-2-ylmethylsulfanyl)phenyl]urea;methane.
| Compound Name | 1,3-diamino-1-[3-cyclobutyl-2-(thiophen-2-ylmethylsulfanyl)phenyl]urea;methane |
|---|---|
| PubChem CID | 144838377 |
| Molecular Formula | C17H24N4OS2 |
| Molecular Weight | 364.54 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 1,3-diamino-1-[3-cyclobutyl-2-(thiophen-2-ylmethylsulfanyl)phenyl]urea;methane |
| SMILES | C.NNC(=O)N(N)c1cccc(C2CCC2)c1SCc1cccs1 |
| InChI | InChI=1S/C16H20N4OS2.CH4/c17-19-16(21)20(18)14-8-2-7-13(11-4-1-5-11)15(14)23-10-12-6-3-9-22-12;/h2-3,6-9,11H,1,4-5,10,17-18H2,(H,19,21);1H4 |
| InChIKey | HQVGTUUFDLBYRE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.54 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|