C8H9NOS2 — CID 54187790
4-(thiophen-2-ylmethylsulfanyl)azetidin-2-one (PubChem CID 54187790) has the molecular formula C8H9NOS2 and a molecular weight of 199.30 g/mol. Its IUPAC name is 4-(thiophen-2-ylmethylsulfanyl)azetidin-2-one.
| Compound Name | 4-(thiophen-2-ylmethylsulfanyl)azetidin-2-one |
|---|---|
| PubChem CID | 54187790 |
| Molecular Formula | C8H9NOS2 |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.01 |
| IUPAC Name | 4-(thiophen-2-ylmethylsulfanyl)azetidin-2-one |
| SMILES | O=C1CC(SCc2cccs2)N1 |
| InChI | InChI=1S/C8H9NOS2/c10-7-4-8(9-7)12-5-6-2-1-3-11-6/h1-3,8H,4-5H2,(H,9,10) |
| InChIKey | PGHZSBDNIZNTIC-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |