C10H12N2O2S2 — CID 142631268
2-[2-oxo-4-(thiophen-2-ylmethylsulfanyl)azetidin-1-yl]acetamide (PubChem CID 142631268) has the molecular formula C10H12N2O2S2 and a molecular weight of 256.35 g/mol. Its IUPAC name is 2-[2-oxo-4-(thiophen-2-ylmethylsulfanyl)azetidin-1-yl]acetamide.
| Compound Name | 2-[2-oxo-4-(thiophen-2-ylmethylsulfanyl)azetidin-1-yl]acetamide |
|---|---|
| PubChem CID | 142631268 |
| Molecular Formula | C10H12N2O2S2 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | 2-[2-oxo-4-(thiophen-2-ylmethylsulfanyl)azetidin-1-yl]acetamide |
| SMILES | NC(=O)CN1C(=O)CC1SCc1cccs1 |
| InChI | InChI=1S/C10H12N2O2S2/c11-8(13)5-12-9(14)4-10(12)16-6-7-2-1-3-15-7/h1-3,10H,4-6H2,(H2,11,13) |
| InChIKey | BKTYIYUMSDWWPJ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |