C18H20N2O4S2 — CID 68746029
2-[3,6-dioxo-1,4-bis(2-thiophen-2-ylethyl)piperazin-2-yl]acetic acid (PubChem CID 68746029) has the molecular formula C18H20N2O4S2 and a molecular weight of 392.50 g/mol. Its IUPAC name is 2-[3,6-dioxo-1,4-bis(2-thiophen-2-ylethyl)piperazin-2-yl]acetic acid.
| Compound Name | 2-[3,6-dioxo-1,4-bis(2-thiophen-2-ylethyl)piperazin-2-yl]acetic acid |
|---|---|
| PubChem CID | 68746029 |
| Molecular Formula | C18H20N2O4S2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | 2-[3,6-dioxo-1,4-bis(2-thiophen-2-ylethyl)piperazin-2-yl]acetic acid |
| SMILES | O=C(O)CC1C(=O)N(CCc2cccs2)CC(=O)N1CCc1cccs1 |
| InChI | InChI=1S/C18H20N2O4S2/c21-16-12-19(7-5-13-3-1-9-25-13)18(24)15(11-17(22)23)20(16)8-6-14-4-2-10-26-14/h1-4,9-10,15H,5-8,11-12H2,(H,22,23) |
| InChIKey | KOTYJDBFFBFXCD-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |