C27H29N5O5S — CID 68747040
2-[3,6-dioxo-4-(2-pyridin-2-ylethyl)-1-(2-thiophen-2-ylethyl)piperazin-2-yl]-N-[2-(4-nitrophenyl)ethyl]acetamide (PubChem CID 68747040) has the molecular formula C27H29N5O5S and a molecular weight of 535.63 g/mol. Its IUPAC name is 2-[3,6-dioxo-4-(2-pyridin-2-ylethyl)-1-(2-thiophen-2-ylethyl)piperazin-2-yl]-N-[2-(4-nitrophenyl)ethyl]acetamide.
| Compound Name | 2-[3,6-dioxo-4-(2-pyridin-2-ylethyl)-1-(2-thiophen-2-ylethyl)piperazin-2-yl]-N-[2-(4-nitrophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 68747040 |
| Molecular Formula | C27H29N5O5S |
| Molecular Weight | 535.63 g/mol |
| Exact Mass | 535.19 |
| IUPAC Name | 2-[3,6-dioxo-4-(2-pyridin-2-ylethyl)-1-(2-thiophen-2-ylethyl)piperazin-2-yl]-N-[2-(4-nitrophenyl)ethyl]acetamide |
| SMILES | O=C(CC1C(=O)N(CCc2ccccn2)CC(=O)N1CCc1cccs1)NCCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H29N5O5S/c33-25(29-14-10-20-6-8-22(9-7-20)32(36)37)18-24-27(35)30(15-11-21-4-1-2-13-28-21)19-26(34)31(24)16-12-23-5-3-17-38-23/h1-9,13,17,24H,10-12,14-16,18-19H2,(H,29,33) |
| InChIKey | YRIBXKDNYYETBS-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 125.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.63 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|