C26H28N4O5S2 — CID 68753212
2-[3,6-dioxo-1,4-bis(2-thiophen-2-ylethyl)piperazin-2-yl]-N-[2-(4-nitrophenyl)ethyl]acetamide (PubChem CID 68753212) has the molecular formula C26H28N4O5S2 and a molecular weight of 540.67 g/mol. Its IUPAC name is 2-[3,6-dioxo-1,4-bis(2-thiophen-2-ylethyl)piperazin-2-yl]-N-[2-(4-nitrophenyl)ethyl]acetamide.
| Compound Name | 2-[3,6-dioxo-1,4-bis(2-thiophen-2-ylethyl)piperazin-2-yl]-N-[2-(4-nitrophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 68753212 |
| Molecular Formula | C26H28N4O5S2 |
| Molecular Weight | 540.67 g/mol |
| Exact Mass | 540.15 |
| IUPAC Name | 2-[3,6-dioxo-1,4-bis(2-thiophen-2-ylethyl)piperazin-2-yl]-N-[2-(4-nitrophenyl)ethyl]acetamide |
| SMILES | O=C(CC1C(=O)N(CCc2cccs2)CC(=O)N1CCc1cccs1)NCCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H28N4O5S2/c31-24(27-12-9-19-5-7-20(8-6-19)30(34)35)17-23-26(33)28(13-10-21-3-1-15-36-21)18-25(32)29(23)14-11-22-4-2-16-37-22/h1-8,15-16,23H,9-14,17-18H2,(H,27,31) |
| InChIKey | MCEALDCZJPBUBR-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.67 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|