C10H14OS2 — CID 127000169
2-methyl-3-(thiophen-2-ylmethylsulfanyl)oxolane (PubChem CID 127000169) has the molecular formula C10H14OS2 and a molecular weight of 214.35 g/mol. Its IUPAC name is 2-methyl-3-(thiophen-2-ylmethylsulfanyl)oxolane.
| Compound Name | 2-methyl-3-(thiophen-2-ylmethylsulfanyl)oxolane |
|---|---|
| PubChem CID | 127000169 |
| Molecular Formula | C10H14OS2 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 2-methyl-3-(thiophen-2-ylmethylsulfanyl)oxolane |
| SMILES | CC1OCCC1SCc1cccs1 |
| InChI | InChI=1S/C10H14OS2/c1-8-10(4-5-11-8)13-7-9-3-2-6-12-9/h2-3,6,8,10H,4-5,7H2,1H3 |
| InChIKey | BKXGCZLLYCIJLT-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |