C20H27FN4O2S — CID 144933964
1,3-diamino-1-[3-cyclopropyl-2-[(5-fluoro-2-methoxyphenyl)sulfanylmethyl]phenyl]urea;ethane (PubChem CID 144933964) has the molecular formula C20H27FN4O2S and a molecular weight of 406.53 g/mol. Its IUPAC name is 1,3-diamino-1-[3-cyclopropyl-2-[(5-fluoro-2-methoxyphenyl)sulfanylmethyl]phenyl]urea;ethane.
| Compound Name | 1,3-diamino-1-[3-cyclopropyl-2-[(5-fluoro-2-methoxyphenyl)sulfanylmethyl]phenyl]urea;ethane |
|---|---|
| PubChem CID | 144933964 |
| Molecular Formula | C20H27FN4O2S |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 1,3-diamino-1-[3-cyclopropyl-2-[(5-fluoro-2-methoxyphenyl)sulfanylmethyl]phenyl]urea;ethane |
| SMILES | CC.COc1ccc(F)cc1SCc1c(C2CC2)cccc1N(N)C(=O)NN |
| InChI | InChI=1S/C18H21FN4O2S.C2H6/c1-25-16-8-7-12(19)9-17(16)26-10-14-13(11-5-6-11)3-2-4-15(14)23(21)18(24)22-20;1-2/h2-4,7-9,11H,5-6,10,20-21H2,1H3,(H,22,24);1-2H3 |
| InChIKey | COUVXOUHADQLET-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|