C18H21BrN2OS — CID 144934022
1-[2-[(5-bromo-2-methoxyphenyl)sulfanylmethyl]-3-cyclopropylphenyl]-1-methylhydrazine (PubChem CID 144934022) has the molecular formula C18H21BrN2OS and a molecular weight of 393.35 g/mol. Its IUPAC name is 1-[2-[(5-bromo-2-methoxyphenyl)sulfanylmethyl]-3-cyclopropylphenyl]-1-methylhydrazine.
| Compound Name | 1-[2-[(5-bromo-2-methoxyphenyl)sulfanylmethyl]-3-cyclopropylphenyl]-1-methylhydrazine |
|---|---|
| PubChem CID | 144934022 |
| Molecular Formula | C18H21BrN2OS |
| Molecular Weight | 393.35 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | 1-[2-[(5-bromo-2-methoxyphenyl)sulfanylmethyl]-3-cyclopropylphenyl]-1-methylhydrazine |
| SMILES | COc1ccc(Br)cc1SCc1c(C2CC2)cccc1N(C)N |
| InChI | InChI=1S/C18H21BrN2OS/c1-21(20)16-5-3-4-14(12-6-7-12)15(16)11-23-18-10-13(19)8-9-17(18)22-2/h3-5,8-10,12H,6-7,11,20H2,1-2H3 |
| InChIKey | QNABVESBNQTFGR-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.35 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|