C16H17F3N2OS — CID 144934063
1-[2-[[2-methoxy-5-(trifluoromethyl)phenyl]sulfanylmethyl]phenyl]-1-methylhydrazine (PubChem CID 144934063) has the molecular formula C16H17F3N2OS and a molecular weight of 342.39 g/mol. Its IUPAC name is 1-[2-[[2-methoxy-5-(trifluoromethyl)phenyl]sulfanylmethyl]phenyl]-1-methylhydrazine.
| Compound Name | 1-[2-[[2-methoxy-5-(trifluoromethyl)phenyl]sulfanylmethyl]phenyl]-1-methylhydrazine |
|---|---|
| PubChem CID | 144934063 |
| Molecular Formula | C16H17F3N2OS |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 1-[2-[[2-methoxy-5-(trifluoromethyl)phenyl]sulfanylmethyl]phenyl]-1-methylhydrazine |
| SMILES | COc1ccc(C(F)(F)F)cc1SCc1ccccc1N(C)N |
| InChI | InChI=1S/C16H17F3N2OS/c1-21(20)13-6-4-3-5-11(13)10-23-15-9-12(16(17,18)19)7-8-14(15)22-2/h3-9H,10,20H2,1-2H3 |
| InChIKey | GVVCZMJOELTRNP-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|