C19H18F6O2 — CID 160779473
(1R)-1-[2,5-bis(trifluoromethyl)phenyl]-4-(2-methoxyphenyl)butan-1-ol (PubChem CID 160779473) has the molecular formula C19H18F6O2 and a molecular weight of 392.34 g/mol. Its IUPAC name is (1R)-1-[2,5-bis(trifluoromethyl)phenyl]-4-(2-methoxyphenyl)butan-1-ol.
| Compound Name | (1R)-1-[2,5-bis(trifluoromethyl)phenyl]-4-(2-methoxyphenyl)butan-1-ol |
|---|---|
| PubChem CID | 160779473 |
| Molecular Formula | C19H18F6O2 |
| Molecular Weight | 392.34 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | (1R)-1-[2,5-bis(trifluoromethyl)phenyl]-4-(2-methoxyphenyl)butan-1-ol |
| SMILES | COc1ccccc1CCC[C@@H](O)c1cc(C(F)(F)F)ccc1C(F)(F)F |
| InChI | InChI=1S/C19H18F6O2/c1-27-17-8-3-2-5-12(17)6-4-7-16(26)14-11-13(18(20,21)22)9-10-15(14)19(23,24)25/h2-3,5,8-11,16,26H,4,6-7H2,1H3/t16-/m1/s1 |
| InChIKey | RQLNYYLHLLCIFG-MRXNPFEDSA-N |
| XLogP | 5.79 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.34 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |