C18H23ClF2N4O2S — CID 144933974
N-amino-N-methylformamide;1-[3-chloro-2-[[5-(difluoromethyl)-2-methoxyphenyl]sulfanylmethyl]phenyl]-1-methylhydrazine (PubChem CID 144933974) has the molecular formula C18H23ClF2N4O2S and a molecular weight of 432.92 g/mol. Its IUPAC name is N-amino-N-methylformamide;1-[3-chloro-2-[[5-(difluoromethyl)-2-methoxyphenyl]sulfanylmethyl]phenyl]-1-methylhydrazine.
| Compound Name | N-amino-N-methylformamide;1-[3-chloro-2-[[5-(difluoromethyl)-2-methoxyphenyl]sulfanylmethyl]phenyl]-1-methylhydrazine |
|---|---|
| PubChem CID | 144933974 |
| Molecular Formula | C18H23ClF2N4O2S |
| Molecular Weight | 432.92 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | N-amino-N-methylformamide;1-[3-chloro-2-[[5-(difluoromethyl)-2-methoxyphenyl]sulfanylmethyl]phenyl]-1-methylhydrazine |
| SMILES | CN(N)C=O.COc1ccc(C(F)F)cc1SCc1c(Cl)cccc1N(C)N |
| InChI | InChI=1S/C16H17ClF2N2OS.C2H6N2O/c1-21(20)13-5-3-4-12(17)11(13)9-23-15-8-10(16(18)19)6-7-14(15)22-2;1-4(3)2-5/h3-8,16H,9,20H2,1-2H3;2H,3H2,1H3 |
| InChIKey | GBNQLOFUZBUMGD-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 84.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.92 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|