C16H19ClN4O2S — CID 144838746
N-[2-[2-[(2-chlorophenyl)methylsulfanyl]-3-methoxy-N-methylanilino]hydrazinyl]formamide (PubChem CID 144838746) has the molecular formula C16H19ClN4O2S and a molecular weight of 366.87 g/mol. Its IUPAC name is N-[2-[2-[(2-chlorophenyl)methylsulfanyl]-3-methoxy-N-methylanilino]hydrazinyl]formamide.
| Compound Name | N-[2-[2-[(2-chlorophenyl)methylsulfanyl]-3-methoxy-N-methylanilino]hydrazinyl]formamide |
|---|---|
| PubChem CID | 144838746 |
| Molecular Formula | C16H19ClN4O2S |
| Molecular Weight | 366.87 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | N-[2-[2-[(2-chlorophenyl)methylsulfanyl]-3-methoxy-N-methylanilino]hydrazinyl]formamide |
| SMILES | COc1cccc(N(C)NNNC=O)c1SCc1ccccc1Cl |
| InChI | InChI=1S/C16H19ClN4O2S/c1-21(20-19-18-11-22)14-8-5-9-15(23-2)16(14)24-10-12-6-3-4-7-13(12)17/h3-9,11,19-20H,10H2,1-2H3,(H,18,22) |
| InChIKey | CUBNWWHICHONDU-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.87 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|