C19H19ClN2O3S2 — CID 39883777
(3aS,6aR)-2-[(2-chlorophenyl)methylsulfanyl]-3-(2-methoxyphenyl)-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide (PubChem CID 39883777) has the molecular formula C19H19ClN2O3S2 and a molecular weight of 422.96 g/mol. Its IUPAC name is (3aS,6aR)-2-[(2-chlorophenyl)methylsulfanyl]-3-(2-methoxyphenyl)-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide.
| Compound Name | (3aS,6aR)-2-[(2-chlorophenyl)methylsulfanyl]-3-(2-methoxyphenyl)-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide |
|---|---|
| PubChem CID | 39883777 |
| Molecular Formula | C19H19ClN2O3S2 |
| Molecular Weight | 422.96 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | (3aS,6aR)-2-[(2-chlorophenyl)methylsulfanyl]-3-(2-methoxyphenyl)-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide |
| SMILES | COc1ccccc1N1C(SCc2ccccc2Cl)=N[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C19H19ClN2O3S2/c1-25-18-9-5-4-8-16(18)22-17-12-27(23,24)11-15(17)21-19(22)26-10-13-6-2-3-7-14(13)20/h2-9,15,17H,10-12H2,1H3/t15-,17+/m0/s1 |
| InChIKey | ISQHZECJFYCIGG-DOTOQJQBSA-N |
| XLogP | 3.62 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.96 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |