C20H20Cl2N2O4S2 — CID 41058359
(3aS,6aS)-2-[(2,6-dichlorophenyl)methylsulfanyl]-3-(3,4-dimethoxyphenyl)-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide (PubChem CID 41058359) has the molecular formula C20H20Cl2N2O4S2 and a molecular weight of 487.43 g/mol. Its IUPAC name is (3aS,6aS)-2-[(2,6-dichlorophenyl)methylsulfanyl]-3-(3,4-dimethoxyphenyl)-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide.
| Compound Name | (3aS,6aS)-2-[(2,6-dichlorophenyl)methylsulfanyl]-3-(3,4-dimethoxyphenyl)-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide |
|---|---|
| PubChem CID | 41058359 |
| Molecular Formula | C20H20Cl2N2O4S2 |
| Molecular Weight | 487.43 g/mol |
| Exact Mass | 486.02 |
| IUPAC Name | (3aS,6aS)-2-[(2,6-dichlorophenyl)methylsulfanyl]-3-(3,4-dimethoxyphenyl)-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide |
| SMILES | COc1ccc(N2C(SCc3c(Cl)cccc3Cl)=N[C@@H]3CS(=O)(=O)C[C@H]32)cc1OC |
| InChI | InChI=1S/C20H20Cl2N2O4S2/c1-27-18-7-6-12(8-19(18)28-2)24-17-11-30(25,26)10-16(17)23-20(24)29-9-13-14(21)4-3-5-15(13)22/h3-8,16-17H,9-11H2,1-2H3/t16-,17-/m1/s1 |
| InChIKey | HONKDBRECWEONY-IAGOWNOFSA-N |
| XLogP | 4.29 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.43 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |