C19H18Cl2N2O3S2 — CID 39883091
(3aR,6aR)-3-(3,5-dichlorophenyl)-2-[(4-methoxyphenyl)methylsulfanyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide (PubChem CID 39883091) has the molecular formula C19H18Cl2N2O3S2 and a molecular weight of 457.40 g/mol. Its IUPAC name is (3aR,6aR)-3-(3,5-dichlorophenyl)-2-[(4-methoxyphenyl)methylsulfanyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide.
| Compound Name | (3aR,6aR)-3-(3,5-dichlorophenyl)-2-[(4-methoxyphenyl)methylsulfanyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide |
|---|---|
| PubChem CID | 39883091 |
| Molecular Formula | C19H18Cl2N2O3S2 |
| Molecular Weight | 457.40 g/mol |
| Exact Mass | 456.01 |
| IUPAC Name | (3aR,6aR)-3-(3,5-dichlorophenyl)-2-[(4-methoxyphenyl)methylsulfanyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide |
| SMILES | COc1ccc(CSC2=N[C@H]3CS(=O)(=O)C[C@@H]3N2c2cc(Cl)cc(Cl)c2)cc1 |
| InChI | InChI=1S/C19H18Cl2N2O3S2/c1-26-16-4-2-12(3-5-16)9-27-19-22-17-10-28(24,25)11-18(17)23(19)15-7-13(20)6-14(21)8-15/h2-8,17-18H,9-11H2,1H3/t17-,18-/m0/s1 |
| InChIKey | XDKDQOFRRNXWPF-ROUUACIJSA-N |
| XLogP | 4.28 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.40 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |