C20H21FN2O3S2 — CID 41063905
(3aS,6aR)-3-(4-fluorophenyl)-2-[2-(4-methoxyphenyl)ethylsulfanyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide (PubChem CID 41063905) has the molecular formula C20H21FN2O3S2 and a molecular weight of 420.53 g/mol. Its IUPAC name is (3aS,6aR)-3-(4-fluorophenyl)-2-[2-(4-methoxyphenyl)ethylsulfanyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide.
| Compound Name | (3aS,6aR)-3-(4-fluorophenyl)-2-[2-(4-methoxyphenyl)ethylsulfanyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide |
|---|---|
| PubChem CID | 41063905 |
| Molecular Formula | C20H21FN2O3S2 |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | (3aS,6aR)-3-(4-fluorophenyl)-2-[2-(4-methoxyphenyl)ethylsulfanyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide |
| SMILES | COc1ccc(CCSC2=N[C@H]3CS(=O)(=O)C[C@H]3N2c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C20H21FN2O3S2/c1-26-17-8-2-14(3-9-17)10-11-27-20-22-18-12-28(24,25)13-19(18)23(20)16-6-4-15(21)5-7-16/h2-9,18-19H,10-13H2,1H3/t18-,19+/m0/s1 |
| InChIKey | RYUYHMMCIRKJEQ-RBUKOAKNSA-N |
| XLogP | 3.15 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |