C21H22N2O5S2 — CID 41010112
benzyl 2-[[(3aR,6aS)-3-(3-methoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-yl]sulfanyl]acetate (PubChem CID 41010112) has the molecular formula C21H22N2O5S2 and a molecular weight of 446.55 g/mol. Its IUPAC name is benzyl 2-[[(3aR,6aS)-3-(3-methoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-yl]sulfanyl]acetate.
| Compound Name | benzyl 2-[[(3aR,6aS)-3-(3-methoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 41010112 |
| Molecular Formula | C21H22N2O5S2 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | benzyl 2-[[(3aR,6aS)-3-(3-methoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-yl]sulfanyl]acetate |
| SMILES | COc1cccc(N2C(SCC(=O)OCc3ccccc3)=N[C@@H]3CS(=O)(=O)C[C@@H]32)c1 |
| InChI | InChI=1S/C21H22N2O5S2/c1-27-17-9-5-8-16(10-17)23-19-14-30(25,26)13-18(19)22-21(23)29-12-20(24)28-11-15-6-3-2-4-7-15/h2-10,18-19H,11-14H2,1H3/t18-,19+/m1/s1 |
| InChIKey | AETJOYCYSYABOQ-MOPGFXCFSA-N |
| XLogP | 2.51 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |