C20H20N2O4S2 — CID 41009885
benzyl 2-[[(3aR,6aS)-5,5-dioxo-3-phenyl-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-yl]sulfanyl]acetate (PubChem CID 41009885) has the molecular formula C20H20N2O4S2 and a molecular weight of 416.52 g/mol. Its IUPAC name is benzyl 2-[[(3aR,6aS)-5,5-dioxo-3-phenyl-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-yl]sulfanyl]acetate.
| Compound Name | benzyl 2-[[(3aR,6aS)-5,5-dioxo-3-phenyl-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 41009885 |
| Molecular Formula | C20H20N2O4S2 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | benzyl 2-[[(3aR,6aS)-5,5-dioxo-3-phenyl-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-yl]sulfanyl]acetate |
| SMILES | O=C(CSC1=N[C@@H]2CS(=O)(=O)C[C@@H]2N1c1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C20H20N2O4S2/c23-19(26-11-15-7-3-1-4-8-15)12-27-20-21-17-13-28(24,25)14-18(17)22(20)16-9-5-2-6-10-16/h1-10,17-18H,11-14H2/t17-,18+/m1/s1 |
| InChIKey | ILTZZTTVNIUYIU-MSOLQXFVSA-N |
| XLogP | 2.50 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |