C18H16Cl2N2O2S2 — CID 41026636
(3aS,6aS)-2-[(2,6-dichlorophenyl)methylsulfanyl]-3-phenyl-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide (PubChem CID 41026636) has the molecular formula C18H16Cl2N2O2S2 and a molecular weight of 427.38 g/mol. Its IUPAC name is (3aS,6aS)-2-[(2,6-dichlorophenyl)methylsulfanyl]-3-phenyl-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide.
| Compound Name | (3aS,6aS)-2-[(2,6-dichlorophenyl)methylsulfanyl]-3-phenyl-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide |
|---|---|
| PubChem CID | 41026636 |
| Molecular Formula | C18H16Cl2N2O2S2 |
| Molecular Weight | 427.38 g/mol |
| Exact Mass | 426.00 |
| IUPAC Name | (3aS,6aS)-2-[(2,6-dichlorophenyl)methylsulfanyl]-3-phenyl-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide |
| SMILES | O=S1(=O)C[C@@H]2[C@@H](C1)N=C(SCc1c(Cl)cccc1Cl)N2c1ccccc1 |
| InChI | InChI=1S/C18H16Cl2N2O2S2/c19-14-7-4-8-15(20)13(14)9-25-18-21-16-10-26(23,24)11-17(16)22(18)12-5-2-1-3-6-12/h1-8,16-17H,9-11H2/t16-,17-/m1/s1 |
| InChIKey | BNYXICNYSZGCFN-IAGOWNOFSA-N |
| XLogP | 4.27 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.38 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |