C20H19ClN2O3S2 — CID 39883812
1-[3-[(3aR,6aS)-2-[(2-chlorophenyl)methylsulfanyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-3-yl]phenyl]ethanone (PubChem CID 39883812) has the molecular formula C20H19ClN2O3S2 and a molecular weight of 434.97 g/mol. Its IUPAC name is 1-[3-[(3aR,6aS)-2-[(2-chlorophenyl)methylsulfanyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-3-yl]phenyl]ethanone.
| Compound Name | 1-[3-[(3aR,6aS)-2-[(2-chlorophenyl)methylsulfanyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-3-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 39883812 |
| Molecular Formula | C20H19ClN2O3S2 |
| Molecular Weight | 434.97 g/mol |
| Exact Mass | 434.05 |
| IUPAC Name | 1-[3-[(3aR,6aS)-2-[(2-chlorophenyl)methylsulfanyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-3-yl]phenyl]ethanone |
| SMILES | CC(=O)c1cccc(N2C(SCc3ccccc3Cl)=N[C@@H]3CS(=O)(=O)C[C@@H]32)c1 |
| InChI | InChI=1S/C20H19ClN2O3S2/c1-13(24)14-6-4-7-16(9-14)23-19-12-28(25,26)11-18(19)22-20(23)27-10-15-5-2-3-8-17(15)21/h2-9,18-19H,10-12H2,1H3/t18-,19+/m1/s1 |
| InChIKey | DLHHQDLIZGNHOJ-MOPGFXCFSA-N |
| XLogP | 3.82 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.97 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |