C21H20ClN3O4S2 — CID 39883491
2-[[(3aS,6aS)-3-(3-acetylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-yl]sulfanyl]-N-(3-chlorophenyl)acetamide (PubChem CID 39883491) has the molecular formula C21H20ClN3O4S2 and a molecular weight of 478.00 g/mol. Its IUPAC name is 2-[[(3aS,6aS)-3-(3-acetylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-yl]sulfanyl]-N-(3-chlorophenyl)acetamide.
| Compound Name | 2-[[(3aS,6aS)-3-(3-acetylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-yl]sulfanyl]-N-(3-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 39883491 |
| Molecular Formula | C21H20ClN3O4S2 |
| Molecular Weight | 478.00 g/mol |
| Exact Mass | 477.06 |
| IUPAC Name | 2-[[(3aS,6aS)-3-(3-acetylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-yl]sulfanyl]-N-(3-chlorophenyl)acetamide |
| SMILES | CC(=O)c1cccc(N2C(SCC(=O)Nc3cccc(Cl)c3)=N[C@@H]3CS(=O)(=O)C[C@H]32)c1 |
| InChI | InChI=1S/C21H20ClN3O4S2/c1-13(26)14-4-2-7-17(8-14)25-19-12-31(28,29)11-18(19)24-21(25)30-10-20(27)23-16-6-3-5-15(22)9-16/h2-9,18-19H,10-12H2,1H3,(H,23,27)/t18-,19-/m1/s1 |
| InChIKey | FTYPJZUYRLYNFF-RTBURBONSA-N |
| XLogP | 3.26 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.00 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |