C20H19Cl2N3O3S2 — CID 43839400
N-(3-chloro-2-methylphenyl)-2-[[3-(3-chlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-yl]sulfanyl]acetamide (PubChem CID 43839400) has the molecular formula C20H19Cl2N3O3S2 and a molecular weight of 484.43 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-2-[[3-(3-chlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-2-[[3-(3-chlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 43839400 |
| Molecular Formula | C20H19Cl2N3O3S2 |
| Molecular Weight | 484.43 g/mol |
| Exact Mass | 483.02 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-2-[[3-(3-chlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-yl]sulfanyl]acetamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)CSC1=NC2CS(=O)(=O)CC2N1c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H19Cl2N3O3S2/c1-12-15(22)6-3-7-16(12)23-19(26)9-29-20-24-17-10-30(27,28)11-18(17)25(20)14-5-2-4-13(21)8-14/h2-8,17-18H,9-11H2,1H3,(H,23,26) |
| InChIKey | YKDWDVMNNBKSDQ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.43 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |