C21H23N3O3S2 — CID 43839351
N-(2,5-dimethylphenyl)-2-[(5,5-dioxo-3-phenyl-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-yl)sulfanyl]acetamide (PubChem CID 43839351) has the molecular formula C21H23N3O3S2 and a molecular weight of 429.57 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-2-[(5,5-dioxo-3-phenyl-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-(2,5-dimethylphenyl)-2-[(5,5-dioxo-3-phenyl-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 43839351 |
| Molecular Formula | C21H23N3O3S2 |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | N-(2,5-dimethylphenyl)-2-[(5,5-dioxo-3-phenyl-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-yl)sulfanyl]acetamide |
| SMILES | Cc1ccc(C)c(NC(=O)CSC2=NC3CS(=O)(=O)CC3N2c2ccccc2)c1 |
| InChI | InChI=1S/C21H23N3O3S2/c1-14-8-9-15(2)17(10-14)22-20(25)11-28-21-23-18-12-29(26,27)13-19(18)24(21)16-6-4-3-5-7-16/h3-10,18-19H,11-13H2,1-2H3,(H,22,25) |
| InChIKey | DYSZGLASEOIZPO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |