C21H21Cl2N3O3S2 — CID 39883652
2-[[(3aS,6aR)-3-(3,5-dichlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-yl]sulfanyl]-N-(2,3-dimethylphenyl)acetamide (PubChem CID 39883652) has the molecular formula C21H21Cl2N3O3S2 and a molecular weight of 498.46 g/mol. Its IUPAC name is 2-[[(3aS,6aR)-3-(3,5-dichlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-yl]sulfanyl]-N-(2,3-dimethylphenyl)acetamide.
| Compound Name | 2-[[(3aS,6aR)-3-(3,5-dichlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-yl]sulfanyl]-N-(2,3-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 39883652 |
| Molecular Formula | C21H21Cl2N3O3S2 |
| Molecular Weight | 498.46 g/mol |
| Exact Mass | 497.04 |
| IUPAC Name | 2-[[(3aS,6aR)-3-(3,5-dichlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-yl]sulfanyl]-N-(2,3-dimethylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)CSC2=N[C@H]3CS(=O)(=O)C[C@H]3N2c2cc(Cl)cc(Cl)c2)c1C |
| InChI | InChI=1S/C21H21Cl2N3O3S2/c1-12-4-3-5-17(13(12)2)24-20(27)9-30-21-25-18-10-31(28,29)11-19(18)26(21)16-7-14(22)6-15(23)8-16/h3-8,18-19H,9-11H2,1-2H3,(H,24,27)/t18-,19+/m0/s1 |
| InChIKey | UHKUEZVSOKJRBB-RBUKOAKNSA-N |
| XLogP | 4.32 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.46 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |