C21H22ClN3O3S2 — CID 39883699
2-[[(3aS,6aS)-3-(4-methylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-yl]sulfanyl]-N-(3-chloro-2-methylphenyl)acetamide (PubChem CID 39883699) has the molecular formula C21H22ClN3O3S2 and a molecular weight of 464.01 g/mol. Its IUPAC name is 2-[[(3aS,6aS)-3-(4-methylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-yl]sulfanyl]-N-(3-chloro-2-methylphenyl)acetamide.
| Compound Name | 2-[[(3aS,6aS)-3-(4-methylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-yl]sulfanyl]-N-(3-chloro-2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 39883699 |
| Molecular Formula | C21H22ClN3O3S2 |
| Molecular Weight | 464.01 g/mol |
| Exact Mass | 463.08 |
| IUPAC Name | 2-[[(3aS,6aS)-3-(4-methylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-yl]sulfanyl]-N-(3-chloro-2-methylphenyl)acetamide |
| SMILES | Cc1ccc(N2C(SCC(=O)Nc3cccc(Cl)c3C)=N[C@@H]3CS(=O)(=O)C[C@H]32)cc1 |
| InChI | InChI=1S/C21H22ClN3O3S2/c1-13-6-8-15(9-7-13)25-19-12-30(27,28)11-18(19)24-21(25)29-10-20(26)23-17-5-3-4-16(22)14(17)2/h3-9,18-19H,10-12H2,1-2H3,(H,23,26)/t18-,19-/m1/s1 |
| InChIKey | GDJWPUGWNHXIOY-RTBURBONSA-N |
| XLogP | 3.67 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.01 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |