C22H21ClF3N3O3S2 — CID 94855338
2-[[(3aR,6aR)-3-[2-chloro-5-(trifluoromethyl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-yl]sulfanyl]-N-(2-ethylphenyl)acetamide (PubChem CID 94855338) has the molecular formula C22H21ClF3N3O3S2 and a molecular weight of 532.01 g/mol. Its IUPAC name is 2-[[(3aR,6aR)-3-[2-chloro-5-(trifluoromethyl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-yl]sulfanyl]-N-(2-ethylphenyl)acetamide.
| Compound Name | 2-[[(3aR,6aR)-3-[2-chloro-5-(trifluoromethyl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-yl]sulfanyl]-N-(2-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 94855338 |
| Molecular Formula | C22H21ClF3N3O3S2 |
| Molecular Weight | 532.01 g/mol |
| Exact Mass | 531.07 |
| IUPAC Name | 2-[[(3aR,6aR)-3-[2-chloro-5-(trifluoromethyl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-yl]sulfanyl]-N-(2-ethylphenyl)acetamide |
| SMILES | CCc1ccccc1NC(=O)CSC1=N[C@H]2CS(=O)(=O)C[C@@H]2N1c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C22H21ClF3N3O3S2/c1-2-13-5-3-4-6-16(13)27-20(30)10-33-21-28-17-11-34(31,32)12-19(17)29(21)18-9-14(22(24,25)26)7-8-15(18)23/h3-9,17,19H,2,10-12H2,1H3,(H,27,30)/t17-,19-/m0/s1 |
| InChIKey | WTEZVVRRQIZTBC-HKUYNNGSSA-N |
| XLogP | 4.63 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.01 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |