C19H15ClF4N2O2S2 — CID 39884453
(3aS,6aR)-3-[2-chloro-5-(trifluoromethyl)phenyl]-2-[(2-fluorophenyl)methylsulfanyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide (PubChem CID 39884453) has the molecular formula C19H15ClF4N2O2S2 and a molecular weight of 478.92 g/mol. Its IUPAC name is (3aS,6aR)-3-[2-chloro-5-(trifluoromethyl)phenyl]-2-[(2-fluorophenyl)methylsulfanyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide.
| Compound Name | (3aS,6aR)-3-[2-chloro-5-(trifluoromethyl)phenyl]-2-[(2-fluorophenyl)methylsulfanyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide |
|---|---|
| PubChem CID | 39884453 |
| Molecular Formula | C19H15ClF4N2O2S2 |
| Molecular Weight | 478.92 g/mol |
| Exact Mass | 478.02 |
| IUPAC Name | (3aS,6aR)-3-[2-chloro-5-(trifluoromethyl)phenyl]-2-[(2-fluorophenyl)methylsulfanyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide |
| SMILES | O=S1(=O)C[C@@H]2N=C(SCc3ccccc3F)N(c3cc(C(F)(F)F)ccc3Cl)[C@@H]2C1 |
| InChI | InChI=1S/C19H15ClF4N2O2S2/c20-13-6-5-12(19(22,23)24)7-16(13)26-17-10-30(27,28)9-15(17)25-18(26)29-8-11-3-1-2-4-14(11)21/h1-7,15,17H,8-10H2/t15-,17+/m0/s1 |
| InChIKey | UVPLGMLRUGNQET-DOTOQJQBSA-N |
| XLogP | 4.77 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.92 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |