C18H14Cl2F2N2O2S2 — CID 39884134
(3aR,6aR)-2-[(3,4-dichlorophenyl)methylsulfanyl]-3-(2,4-difluorophenyl)-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide (PubChem CID 39884134) has the molecular formula C18H14Cl2F2N2O2S2 and a molecular weight of 463.36 g/mol. Its IUPAC name is (3aR,6aR)-2-[(3,4-dichlorophenyl)methylsulfanyl]-3-(2,4-difluorophenyl)-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide.
| Compound Name | (3aR,6aR)-2-[(3,4-dichlorophenyl)methylsulfanyl]-3-(2,4-difluorophenyl)-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide |
|---|---|
| PubChem CID | 39884134 |
| Molecular Formula | C18H14Cl2F2N2O2S2 |
| Molecular Weight | 463.36 g/mol |
| Exact Mass | 461.98 |
| IUPAC Name | (3aR,6aR)-2-[(3,4-dichlorophenyl)methylsulfanyl]-3-(2,4-difluorophenyl)-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide |
| SMILES | O=S1(=O)C[C@@H]2N=C(SCc3ccc(Cl)c(Cl)c3)N(c3ccc(F)cc3F)[C@H]2C1 |
| InChI | InChI=1S/C18H14Cl2F2N2O2S2/c19-12-3-1-10(5-13(12)20)7-27-18-23-15-8-28(25,26)9-17(15)24(18)16-4-2-11(21)6-14(16)22/h1-6,15,17H,7-9H2/t15-,17-/m0/s1 |
| InChIKey | LJKBDBKIKOHRIV-RDJZCZTQSA-N |
| XLogP | 4.55 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.36 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |