C18H14Cl4N2O2S2 — CID 43839531
3-(3,5-dichlorophenyl)-2-[(3,4-dichlorophenyl)methylsulfanyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide (PubChem CID 43839531) has the molecular formula C18H14Cl4N2O2S2 and a molecular weight of 496.27 g/mol. Its IUPAC name is 3-(3,5-dichlorophenyl)-2-[(3,4-dichlorophenyl)methylsulfanyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide.
| Compound Name | 3-(3,5-dichlorophenyl)-2-[(3,4-dichlorophenyl)methylsulfanyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide |
|---|---|
| PubChem CID | 43839531 |
| Molecular Formula | C18H14Cl4N2O2S2 |
| Molecular Weight | 496.27 g/mol |
| Exact Mass | 493.93 |
| IUPAC Name | 3-(3,5-dichlorophenyl)-2-[(3,4-dichlorophenyl)methylsulfanyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide |
| SMILES | O=S1(=O)CC2N=C(SCc3ccc(Cl)c(Cl)c3)N(c3cc(Cl)cc(Cl)c3)C2C1 |
| InChI | InChI=1S/C18H14Cl4N2O2S2/c19-11-4-12(20)6-13(5-11)24-17-9-28(25,26)8-16(17)23-18(24)27-7-10-1-2-14(21)15(22)3-10/h1-6,16-17H,7-9H2 |
| InChIKey | PTJQDVGGDZWPAD-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.27 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |