C20H16BrClF3N3O3S2 — CID 94855366
2-[[(3aR,6aR)-3-[2-chloro-5-(trifluoromethyl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-yl]sulfanyl]-N-(4-bromophenyl)acetamide (PubChem CID 94855366) has the molecular formula C20H16BrClF3N3O3S2 and a molecular weight of 582.85 g/mol. Its IUPAC name is 2-[[(3aR,6aR)-3-[2-chloro-5-(trifluoromethyl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-yl]sulfanyl]-N-(4-bromophenyl)acetamide.
| Compound Name | 2-[[(3aR,6aR)-3-[2-chloro-5-(trifluoromethyl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-yl]sulfanyl]-N-(4-bromophenyl)acetamide |
|---|---|
| PubChem CID | 94855366 |
| Molecular Formula | C20H16BrClF3N3O3S2 |
| Molecular Weight | 582.85 g/mol |
| Exact Mass | 580.95 |
| IUPAC Name | 2-[[(3aR,6aR)-3-[2-chloro-5-(trifluoromethyl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-yl]sulfanyl]-N-(4-bromophenyl)acetamide |
| SMILES | O=C(CSC1=N[C@H]2CS(=O)(=O)C[C@@H]2N1c1cc(C(F)(F)F)ccc1Cl)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C20H16BrClF3N3O3S2/c21-12-2-4-13(5-3-12)26-18(29)8-32-19-27-15-9-33(30,31)10-17(15)28(19)16-7-11(20(23,24)25)1-6-14(16)22/h1-7,15,17H,8-10H2,(H,26,29)/t15-,17-/m0/s1 |
| InChIKey | GRPGUKPSELUGEI-RDJZCZTQSA-N |
| XLogP | 4.83 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.85 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |