C21H22ClN3O5S2 — CID 39883470
2-[[(3aR,6aR)-3-(2,5-dimethoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-yl]sulfanyl]-N-(3-chlorophenyl)acetamide (PubChem CID 39883470) has the molecular formula C21H22ClN3O5S2 and a molecular weight of 496.01 g/mol. Its IUPAC name is 2-[[(3aR,6aR)-3-(2,5-dimethoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-yl]sulfanyl]-N-(3-chlorophenyl)acetamide.
| Compound Name | 2-[[(3aR,6aR)-3-(2,5-dimethoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-yl]sulfanyl]-N-(3-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 39883470 |
| Molecular Formula | C21H22ClN3O5S2 |
| Molecular Weight | 496.01 g/mol |
| Exact Mass | 495.07 |
| IUPAC Name | 2-[[(3aR,6aR)-3-(2,5-dimethoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-yl]sulfanyl]-N-(3-chlorophenyl)acetamide |
| SMILES | COc1ccc(OC)c(N2C(SCC(=O)Nc3cccc(Cl)c3)=N[C@H]3CS(=O)(=O)C[C@@H]32)c1 |
| InChI | InChI=1S/C21H22ClN3O5S2/c1-29-15-6-7-19(30-2)17(9-15)25-18-12-32(27,28)11-16(18)24-21(25)31-10-20(26)23-14-5-3-4-13(22)8-14/h3-9,16,18H,10-12H2,1-2H3,(H,23,26)/t16-,18-/m0/s1 |
| InChIKey | YITCTEDUOMOCIY-WMZOPIPTSA-N |
| XLogP | 3.07 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.01 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |