C16H20ClN3O4S2 — CID 40899334
2-[[(3aS,6aS)-3-(5-chloro-2-methoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-yl]sulfanyl]-N,N-dimethylacetamide (PubChem CID 40899334) has the molecular formula C16H20ClN3O4S2 and a molecular weight of 417.94 g/mol. Its IUPAC name is 2-[[(3aS,6aS)-3-(5-chloro-2-methoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-yl]sulfanyl]-N,N-dimethylacetamide.
| Compound Name | 2-[[(3aS,6aS)-3-(5-chloro-2-methoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-yl]sulfanyl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 40899334 |
| Molecular Formula | C16H20ClN3O4S2 |
| Molecular Weight | 417.94 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | 2-[[(3aS,6aS)-3-(5-chloro-2-methoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-yl]sulfanyl]-N,N-dimethylacetamide |
| SMILES | COc1ccc(Cl)cc1N1C(SCC(=O)N(C)C)=N[C@@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C16H20ClN3O4S2/c1-19(2)15(21)7-25-16-18-11-8-26(22,23)9-13(11)20(16)12-6-10(17)4-5-14(12)24-3/h4-6,11,13H,7-9H2,1-3H3/t11-,13-/m1/s1 |
| InChIKey | JBWWPTOTSWANKP-DGCLKSJQSA-N |
| XLogP | 1.51 |
| TPSA | 79.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.94 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |