C23H27N3O5S2 — CID 39883561
2-[[(3aS,6aR)-3-(2,5-dimethoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-yl]sulfanyl]-N-(2,5-dimethylphenyl)acetamide (PubChem CID 39883561) has the molecular formula C23H27N3O5S2 and a molecular weight of 489.62 g/mol. Its IUPAC name is 2-[[(3aS,6aR)-3-(2,5-dimethoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-yl]sulfanyl]-N-(2,5-dimethylphenyl)acetamide.
| Compound Name | 2-[[(3aS,6aR)-3-(2,5-dimethoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-yl]sulfanyl]-N-(2,5-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 39883561 |
| Molecular Formula | C23H27N3O5S2 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | 2-[[(3aS,6aR)-3-(2,5-dimethoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-yl]sulfanyl]-N-(2,5-dimethylphenyl)acetamide |
| SMILES | COc1ccc(OC)c(N2C(SCC(=O)Nc3cc(C)ccc3C)=N[C@H]3CS(=O)(=O)C[C@H]32)c1 |
| InChI | InChI=1S/C23H27N3O5S2/c1-14-5-6-15(2)17(9-14)24-22(27)11-32-23-25-18-12-33(28,29)13-20(18)26(23)19-10-16(30-3)7-8-21(19)31-4/h5-10,18,20H,11-13H2,1-4H3,(H,24,27)/t18-,20+/m0/s1 |
| InChIKey | OJCXYXFNVGUJRU-AZUAARDMSA-N |
| XLogP | 3.03 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |