C21H22N2O3S2 — CID 39884541
1-[3-[(3aR,6aS)-2-[(3-methylphenyl)methylsulfanyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-3-yl]phenyl]ethanone (PubChem CID 39884541) has the molecular formula C21H22N2O3S2 and a molecular weight of 414.55 g/mol. Its IUPAC name is 1-[3-[(3aR,6aS)-2-[(3-methylphenyl)methylsulfanyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-3-yl]phenyl]ethanone.
| Compound Name | 1-[3-[(3aR,6aS)-2-[(3-methylphenyl)methylsulfanyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-3-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 39884541 |
| Molecular Formula | C21H22N2O3S2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | 1-[3-[(3aR,6aS)-2-[(3-methylphenyl)methylsulfanyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-3-yl]phenyl]ethanone |
| SMILES | CC(=O)c1cccc(N2C(SCc3cccc(C)c3)=N[C@@H]3CS(=O)(=O)C[C@@H]32)c1 |
| InChI | InChI=1S/C21H22N2O3S2/c1-14-5-3-6-16(9-14)11-27-21-22-19-12-28(25,26)13-20(19)23(21)18-8-4-7-17(10-18)15(2)24/h3-10,19-20H,11-13H2,1-2H3/t19-,20+/m1/s1 |
| InChIKey | UPKBFVVVOCADOS-UXHICEINSA-N |
| XLogP | 3.47 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |