C16H17F3N2O4S2 — CID 41064673
ethyl 2-[[(3aS,6aR)-5,5-dioxo-3-[3-(trifluoromethyl)phenyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-yl]sulfanyl]acetate (PubChem CID 41064673) has the molecular formula C16H17F3N2O4S2 and a molecular weight of 422.45 g/mol. Its IUPAC name is ethyl 2-[[(3aS,6aR)-5,5-dioxo-3-[3-(trifluoromethyl)phenyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-yl]sulfanyl]acetate.
| Compound Name | ethyl 2-[[(3aS,6aR)-5,5-dioxo-3-[3-(trifluoromethyl)phenyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 41064673 |
| Molecular Formula | C16H17F3N2O4S2 |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | ethyl 2-[[(3aS,6aR)-5,5-dioxo-3-[3-(trifluoromethyl)phenyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-yl]sulfanyl]acetate |
| SMILES | CCOC(=O)CSC1=N[C@H]2CS(=O)(=O)C[C@H]2N1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H17F3N2O4S2/c1-2-25-14(22)7-26-15-20-12-8-27(23,24)9-13(12)21(15)11-5-3-4-10(6-11)16(17,18)19/h3-6,12-13H,2,7-9H2,1H3/t12-,13+/m0/s1 |
| InChIKey | ICMXUVBGJQXXTL-QWHCGFSZSA-N |
| XLogP | 2.34 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |