C27H35N3O3S3 — CID 144839660
ethane;methyl 2-[4-[3-amino-2-butylsulfanyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenoxy]acetate (PubChem CID 144839660) has the molecular formula C27H35N3O3S3 and a molecular weight of 545.80 g/mol. Its IUPAC name is ethane;methyl 2-[4-[3-amino-2-butylsulfanyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenoxy]acetate.
| Compound Name | ethane;methyl 2-[4-[3-amino-2-butylsulfanyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenoxy]acetate |
|---|---|
| PubChem CID | 144839660 |
| Molecular Formula | C27H35N3O3S3 |
| Molecular Weight | 545.80 g/mol |
| Exact Mass | 545.18 |
| IUPAC Name | ethane;methyl 2-[4-[3-amino-2-butylsulfanyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenoxy]acetate |
| SMILES | CC.CC.CCCCSc1sc2nc(-c3nccs3)cc(-c3ccc(OCC(=O)OC)cc3)c2c1N |
| InChI | InChI=1S/C23H23N3O3S3.2C2H6/c1-3-4-10-31-23-20(24)19-16(12-17(26-22(19)32-23)21-25-9-11-30-21)14-5-7-15(8-6-14)29-13-18(27)28-2;2*1-2/h5-9,11-12H,3-4,10,13,24H2,1-2H3;2*1-2H3 |
| InChIKey | DZDIFTMRXWEZQV-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 87.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.80 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|