C26H32N4O3S3 — CID 144839693
2-[4-[3-amino-2-butylsulfanyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenoxy]acetic acid;ethane;ethenamine (PubChem CID 144839693) has the molecular formula C26H32N4O3S3 and a molecular weight of 544.77 g/mol. Its IUPAC name is 2-[4-[3-amino-2-butylsulfanyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenoxy]acetic acid;ethane;ethenamine.
| Compound Name | 2-[4-[3-amino-2-butylsulfanyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenoxy]acetic acid;ethane;ethenamine |
|---|---|
| PubChem CID | 144839693 |
| Molecular Formula | C26H32N4O3S3 |
| Molecular Weight | 544.77 g/mol |
| Exact Mass | 544.16 |
| IUPAC Name | 2-[4-[3-amino-2-butylsulfanyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenoxy]acetic acid;ethane;ethenamine |
| SMILES | C=CN.CC.CCCCSc1sc2nc(-c3nccs3)cc(-c3ccc(OCC(=O)O)cc3)c2c1N |
| InChI | InChI=1S/C22H21N3O3S3.C2H5N.C2H6/c1-2-3-9-30-22-19(23)18-15(13-4-6-14(7-5-13)28-12-17(26)27)11-16(25-21(18)31-22)20-24-8-10-29-20;1-2-3;1-2/h4-8,10-11H,2-3,9,12,23H2,1H3,(H,26,27);2H,1,3H2;1-2H3 |
| InChIKey | BDICMXUNBCEKSV-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 124.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.77 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|