C22H21N3O3S3 — CID 144839694
2-[4-[3-amino-2-butylsulfanyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenoxy]acetic acid (PubChem CID 144839694) has the molecular formula C22H21N3O3S3 and a molecular weight of 471.63 g/mol. Its IUPAC name is 2-[4-[3-amino-2-butylsulfanyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenoxy]acetic acid.
| Compound Name | 2-[4-[3-amino-2-butylsulfanyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 144839694 |
| Molecular Formula | C22H21N3O3S3 |
| Molecular Weight | 471.63 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | 2-[4-[3-amino-2-butylsulfanyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenoxy]acetic acid |
| SMILES | CCCCSc1sc2nc(-c3nccs3)cc(-c3ccc(OCC(=O)O)cc3)c2c1N |
| InChI | InChI=1S/C22H21N3O3S3/c1-2-3-9-30-22-19(23)18-15(13-4-6-14(7-5-13)28-12-17(26)27)11-16(25-21(18)31-22)20-24-8-10-29-20/h4-8,10-11H,2-3,9,12,23H2,1H3,(H,26,27) |
| InChIKey | XKTHCCQDUFRCPP-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.63 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|