C33H49ClN4O4 — CID 144839879
1-[6-[(2E,4E)-5-chlorohexa-2,4-dien-2-yl]oxy-2-pyridinyl]pyrrolidine-3-carboxamide;1-[3-(3,4-dimethoxyphenyl)propyl]pyrrolidine;ethane (PubChem CID 144839879) has the molecular formula C33H49ClN4O4 and a molecular weight of 601.23 g/mol. Its IUPAC name is 1-[6-[(2E,4E)-5-chlorohexa-2,4-dien-2-yl]oxy-2-pyridinyl]pyrrolidine-3-carboxamide;1-[3-(3,4-dimethoxyphenyl)propyl]pyrrolidine;ethane.
| Compound Name | 1-[6-[(2E,4E)-5-chlorohexa-2,4-dien-2-yl]oxy-2-pyridinyl]pyrrolidine-3-carboxamide;1-[3-(3,4-dimethoxyphenyl)propyl]pyrrolidine;ethane |
|---|---|
| PubChem CID | 144839879 |
| Molecular Formula | C33H49ClN4O4 |
| Molecular Weight | 601.23 g/mol |
| Exact Mass | 600.34 |
| IUPAC Name | 1-[6-[(2E,4E)-5-chlorohexa-2,4-dien-2-yl]oxy-2-pyridinyl]pyrrolidine-3-carboxamide;1-[3-(3,4-dimethoxyphenyl)propyl]pyrrolidine;ethane |
| SMILES | C/C(Cl)=C\C=C(/C)Oc1cccc(N2CCC(C(N)=O)C2)n1.CC.COc1ccc(CCCN2CCCC2)cc1OC |
| InChI | InChI=1S/C16H20ClN3O2.C15H23NO2.C2H6/c1-11(17)6-7-12(2)22-15-5-3-4-14(19-15)20-9-8-13(10-20)16(18)21;1-17-14-8-7-13(12-15(14)18-2)6-5-11-16-9-3-4-10-16;1-2/h3-7,13H,8-10H2,1-2H3,(H2,18,21);7-8,12H,3-6,9-11H2,1-2H3;1-2H3/b11-6+,12-7+;; |
| InChIKey | KDLFEAMTGKJRLY-YTSWEKPFSA-N |
| XLogP | 6.58 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.23 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|