C31H34ClFN3O3- — CID 144840075
(3R)-N-[1-[3-chloro-4-(oxetan-3-yloxy)phenyl]-3-pyrrolidin-1-ylpropan-2-yl]-1-(6-fluoronaphthalen-2-yl)pyrrolidine-3-carboximidate (PubChem CID 144840075) has the molecular formula C31H34ClFN3O3- and a molecular weight of 551.08 g/mol. Its IUPAC name is (3R)-N-[1-[3-chloro-4-(oxetan-3-yloxy)phenyl]-3-pyrrolidin-1-ylpropan-2-yl]-1-(6-fluoronaphthalen-2-yl)pyrrolidine-3-carboximidate.
| Compound Name | (3R)-N-[1-[3-chloro-4-(oxetan-3-yloxy)phenyl]-3-pyrrolidin-1-ylpropan-2-yl]-1-(6-fluoronaphthalen-2-yl)pyrrolidine-3-carboximidate |
|---|---|
| PubChem CID | 144840075 |
| Molecular Formula | C31H34ClFN3O3- |
| Molecular Weight | 551.08 g/mol |
| Exact Mass | 550.23 |
| IUPAC Name | (3R)-N-[1-[3-chloro-4-(oxetan-3-yloxy)phenyl]-3-pyrrolidin-1-ylpropan-2-yl]-1-(6-fluoronaphthalen-2-yl)pyrrolidine-3-carboximidate |
| SMILES | [O-]/C(=N\C(Cc1ccc(OC2COC2)c(Cl)c1)CN1CCCC1)[C@@H]1CCN(c2ccc3cc(F)ccc3c2)C1 |
| InChI | InChI=1S/C31H35ClFN3O3/c32-29-14-21(3-8-30(29)39-28-19-38-20-28)13-26(18-35-10-1-2-11-35)34-31(37)24-9-12-36(17-24)27-7-5-22-15-25(33)6-4-23(22)16-27/h3-8,14-16,24,26,28H,1-2,9-13,17-20H2,(H,34,37)/p-1/t24-,26?/m1/s1 |
| InChIKey | FYTUXPNGWOQPGQ-RMVMEJTISA-M |
| XLogP | 4.70 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.08 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|