C23H24N4O3 — CID 144840539
4-[3-amino-6-(furan-3-yl)pyrazin-2-yl]-N-[(2E)-2-ethenylpenta-2,4-dienyl]benzamide;methanol (PubChem CID 144840539) has the molecular formula C23H24N4O3 and a molecular weight of 404.47 g/mol. Its IUPAC name is 4-[3-amino-6-(furan-3-yl)pyrazin-2-yl]-N-[(2E)-2-ethenylpenta-2,4-dienyl]benzamide;methanol.
| Compound Name | 4-[3-amino-6-(furan-3-yl)pyrazin-2-yl]-N-[(2E)-2-ethenylpenta-2,4-dienyl]benzamide;methanol |
|---|---|
| PubChem CID | 144840539 |
| Molecular Formula | C23H24N4O3 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 4-[3-amino-6-(furan-3-yl)pyrazin-2-yl]-N-[(2E)-2-ethenylpenta-2,4-dienyl]benzamide;methanol |
| SMILES | C=C/C=C(\C=C)CNC(=O)c1ccc(-c2nc(-c3ccoc3)cnc2N)cc1.CO |
| InChI | InChI=1S/C22H20N4O2.CH4O/c1-3-5-15(4-2)12-25-22(27)17-8-6-16(7-9-17)20-21(23)24-13-19(26-20)18-10-11-28-14-18;1-2/h3-11,13-14H,1-2,12H2,(H2,23,24)(H,25,27);2H,1H3/b15-5+; |
| InChIKey | OZCATLJVHMILSX-GBDQXREISA-N |
| XLogP | 3.62 |
| TPSA | 114.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|