C9H19NO — CID 144841125
2-(3-ethyloxetan-3-yl)-N,N-dimethylethanamine (PubChem CID 144841125) has the molecular formula C9H19NO and a molecular weight of 157.26 g/mol. Its IUPAC name is 2-(3-ethyloxetan-3-yl)-N,N-dimethylethanamine.
| Compound Name | 2-(3-ethyloxetan-3-yl)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 144841125 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | 2-(3-ethyloxetan-3-yl)-N,N-dimethylethanamine |
| SMILES | CCC1(CCN(C)C)COC1 |
| InChI | InChI=1S/C9H19NO/c1-4-9(7-11-8-9)5-6-10(2)3/h4-8H2,1-3H3 |
| InChIKey | BSRRKVXDWKLTHB-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |