About 2-(1,3-diethylpyrrolidin-3-yl)-N,N-dimethylethanamine
2-(1,3-diethylpyrrolidin-3-yl)-N,N-dimethylethanamine (PubChem CID 170066692) has the molecular formula C12H26N2
and a molecular weight of 198.35 g/mol. Its IUPAC name is 2-(1,3-diethylpyrrolidin-3-yl)-N,N-dimethylethanamine.
Analyze 2-(1,3-diethylpyrrolidin-3-yl)-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-diethylpyrrolidin-3-yl)-N,N-dimethylethanamine?
The IUPAC name of 2-(1,3-diethylpyrrolidin-3-yl)-N,N-dimethylethanamine (CID 170066692) is 2-(1,3-diethylpyrrolidin-3-yl)-N,N-dimethylethanamine.
What is the SMILES notation for 2-(1,3-diethylpyrrolidin-3-yl)-N,N-dimethylethanamine?
The canonical SMILES for 2-(1,3-diethylpyrrolidin-3-yl)-N,N-dimethylethanamine is CCN1CCC(CC)(CCN(C)C)C1.
What is the InChIKey of 2-(1,3-diethylpyrrolidin-3-yl)-N,N-dimethylethanamine?
The InChIKey is CYHUWLQSJLCBAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N2/c1-5-12(7-9-13(3)4)8-10-14(6-2)11-12/h5-11H2,1-4H3.
What are the key properties of 2-(1,3-diethylpyrrolidin-3-yl)-N,N-dimethylethanamine?
2-(1,3-diethylpyrrolidin-3-yl)-N,N-dimethylethanamine has a molecular weight of 198.35 g/mol, XLogP of 2.06, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-diethylpyrrolidin-3-yl)-N,N-dimethylethanamine is sourced from PubChem (CID 170066692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).